Aminobenzoic acids and derivatives
Aobchem 2-Ethoxy-4-ethynyl-1-methoxybenzene | ≥95% | CAS 881919-82-0 | C11H12O2 | 1g
2-Ethoxy-4-ethynyl-1-methoxybenzene | ≥95% | CAS 881919-82-0 | C11H12O2 | 1g
Aobchem 2-Amino-5-fluorophenyl boronic acid pinacol ester | ≥97% | CAS 863578-24-9 | C12H17BFNO2 | 1g
2-Amino-5-fluorophenyl boronic acid pinacol ester | ≥97% | CAS 863578-24-9 | C12H17BFNO2 | 1g
Aobchem 2-Bromo-5-(tert-butyl)benzoic acid | ≥97% | CAS 1369952-28-2 | C11H13BrO2 | 1g
2-Bromo-5-(tert-butyl)benzoic acid | ≥97% | CAS 1369952-28-2 | C11H13BrO2 | 1g
Aobchem 1-(3-Chloro-5-(dimethylamino)phenyl)ethanone | 95% | CAS 1514120-59-2 | C10H12ClNO | 250mg
1-(3-Chloro-5-(dimethylamino)phenyl)ethanone | 95% | CAS 1514120-59-2 | C10H12ClNO | 250mg
Aobchem 4-Cyclobutyl-2 3-difluorobenzoic acid | 95% | CAS 2918840-96-5 | C11H10F2O2 | 500mg
4-Cyclobutyl-2 3-difluorobenzoic acid | 95% | CAS 2918840-96-5 | C11H10F2O2 | 500mg
Chemscene Azacyclonol | 1g | CS-2754 | 98% | 115-46-8 | MFCD00066980 | 267 37 | C18H21NO
Chemscene | Azacyclonol | 1g | CS-2754 | 98% | 115-46-8 | MFCD00066980 | 267 37 | C18H21NO
Chemscene 2 -Hydroxychalcone | 5g | CS-W013065 | 96% | 1214-47-7 | MFCD00016441 | 224 26 | C15H12O2
Chemscene | 2 -Hydroxychalcone | 5g | CS-W013065 | 96% | 1214-47-7 | MFCD00016441 | 224 26 | C15H12O2
Chemscene 4-Bromo-2 6-difluorobenzonitrile | 10g | CS-W008282 | 98% | 123843-67-4 | MFCD01310981 | 218 | C7H2BrF2N
Chemscene | 4-Bromo-2 6-difluorobenzonitrile | 10g | CS-W008282 | 98% | 123843-67-4 | MFCD01310981 | 218 | C7H2BrF2N
Chemscene 3 4-Dichlorofuran-2 5-dione | 500g | CS-W008267 | 97% | 1122-17-4 | MFCD00005520 | 166 95 | C4Cl2O3
Chemscene | 3 4-Dichlorofuran-2 5-dione | 500g | CS-W008267 | 97% | 1122-17-4 | MFCD00005520 | 166 95 | C4Cl2O3
![eMolecules 1638767-25-5 | tert-butyl N-(3-amino-1-bicyclo[1.1.1]pentanyl)carbamate | Pharmablock | MFCD27987307 | 198.266 | C10H18N2O2 | 97.000 | CC(C)(C)OC(=O)NC12CC(N)(C1)C2 | 25g | 551112106](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000280187.jpg-250.jpg)
eMolecules 1638767-25-5 | tert-butyl N-(3-amino-1-bicyclo[1.1.1]pentanyl)carbamate | Pharmablock | MFCD27987307 | 198.266 | C10H18N2O2 | 97.000 | CC(C)(C)OC(=O)NC12CC(N)(C1)C2 | 25g | 551112106
tert-butyl N-(3-amino-1-bicyclo[1.1.1]pentanyl)carbamate | Pharmablock | 1638767-25-5 | MFCD27987307 | 198.266 | C10H18N2O2 | 97.000 | CC(C)(C)OC(=O)NC12CC(N)(C1)C2 | 25g | 551112106
Chemscene 2 5-Dibromo-3-hexylthiophene | 25g | CS-W009865 | 97% | 116971-11-0 | MFCD00274313 | 326 097 | C10H14Br2S
Chemscene | 2 5-Dibromo-3-hexylthiophene | 25g | CS-W009865 | 97% | 116971-11-0 | MFCD00274313 | 326 097 | C10H14Br2S
Chemscene Veratraldehyde | 25g | CS-W019906 | 98% | 120-14-9 | MFCD00003363 | 166 18 | C9H10O3
Chemscene | Veratraldehyde | 25g | CS-W019906 | 98% | 120-14-9 | MFCD00003363 | 166 18 | C9H10O3
Medchemexpress LLC 2-amino-4-phenylthiazole | 2010-06-2 | MFCD00039680 | 100.0% | 176.24 | C9H8N2S | 10 G
2-Amino-4-phenylthiazole is a thiazole-based synthetic intermediate used in medicinal chemistry and agrochemical research. It is an off-white to light-yellow solid with molecular formula C9H8N2S and molecular weight 176.24 g/mol. High-purity material is provided for reliable performance in small-molecule synthesis and heterocycle construction.
- High purity suitable for research-grade synthesis.
- Useful building block for heterocyclic compound synthesis.
- Solid form simplifies handling and storage.
- Compatible with standard organic synthetic procedures.
- Well-characterized with CAS and MFCD identifiers for traceability.
Chemscene 4-Methoxy-N-phenylaniline | 100g | CS-W010506 | 98% | 1208-86-2 | MFCD00228649 | 199 25 | C13H13NO
Chemscene | 4-Methoxy-N-phenylaniline | 100g | CS-W010506 | 98% | 1208-86-2 | MFCD00228649 | 199 25 | C13H13NO
Chemscene 2 2 5 2 -Terthiophene | 5g | CS-W019822 | 98% | 1081-34-1 | MFCD00012167 | 248 40 | C12H8S3
Chemscene | 2 2 5 2 -Terthiophene | 5g | CS-W019822 | 98% | 1081-34-1 | MFCD00012167 | 248 40 | C12H8S3